![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| A Place to Go/ | 02-Sep-2014 10:07 | - | |
| Accessories for Girls/ | 02-Sep-2014 10:07 | - | |
| Amazing Facts of Fam..> | 02-Sep-2014 10:07 | - | |
| An Ancient Chinese Art/ | 02-Sep-2014 10:07 | - | |
| Appearance/ | 02-Sep-2014 10:07 | - | |
| Apply for a Job/ | 02-Sep-2014 10:07 | - | |
| Art and Language/ | 02-Sep-2014 10:07 | - | |
| At the Restaurant/ | 02-Sep-2014 10:07 | - | |
| Avalanches/ | 02-Sep-2014 10:07 | - | |
| Bargain Hunters/ | 02-Sep-2014 10:07 | - | |
| British Eating Customs/ | 02-Sep-2014 10:07 | - | |
| Broken Bone/ | 02-Sep-2014 10:07 | - | |
| Comparison/ | 02-Sep-2014 10:07 | - | |
| Computer and Technol..> | 02-Sep-2014 10:07 | - | |
| Daily Routine/ | 02-Sep-2014 10:07 | - | |
| Earthquake/ | 02-Sep-2014 10:07 | - | |
| Electrical Safety/ | 02-Sep-2014 10:07 | - | |
| Environmental Concern/ | 02-Sep-2014 10:07 | - | |
| Famous Forever/ | 02-Sep-2014 10:07 | - | |
| Fashion for Girls/ | 02-Sep-2014 10:07 | - | |
| First Aid for Broken..> | 02-Sep-2014 10:07 | - | |
| Floods/ | 02-Sep-2014 10:07 | - | |
| Free Time/ | 02-Sep-2014 10:07 | - | |
| Future Career/ | 02-Sep-2014 10:07 | - | |
| Geography/ | 02-Sep-2014 10:07 | - | |
| Global Warming/ | 02-Sep-2014 10:07 | - | |
| Green Living/ | 02-Sep-2014 10:07 | - | |
| Headgear/ | 02-Sep-2014 10:07 | - | |
| Healing Broken Bones/ | 02-Sep-2014 10:07 | - | |
| Hobbies/ | 02-Sep-2014 10:07 | - | |
| Hotel Rooms/ | 02-Sep-2014 10:07 | - | |
| Hotel Staff/ | 02-Sep-2014 10:07 | - | |
| Hotel Types/ | 02-Sep-2014 10:07 | - | |
| Household Machines/ | 02-Sep-2014 10:07 | - | |
| Housework/ | 02-Sep-2014 10:07 | - | |
| Kitchen Hand/ | 02-Sep-2014 10:07 | - | |
| Let's go on vacation!/ | 02-Sep-2014 10:07 | - | |
| Long-lasting Structure/ | 02-Sep-2014 10:07 | - | |
| Making Hotel Reserva..> | 02-Sep-2014 10:07 | - | |
| Mathematic Symbols/ | 02-Sep-2014 10:07 | - | |
| Movies/ | 02-Sep-2014 10:07 | - | |
| My Feelings/ | 02-Sep-2014 10:07 | - | |
| One Day's Activities..> | 02-Sep-2014 10:07 | - | |
| Pastime Activities/ | 02-Sep-2014 10:07 | - | |
| Save the World for t..> | 02-Sep-2014 10:07 | - | |
| Saving Energy/ | 02-Sep-2014 10:07 | - | |
| Solar System/ | 02-Sep-2014 10:07 | - | |
| Success!/ | 02-Sep-2014 10:07 | - | |
| Television's History/ | 02-Sep-2014 10:07 | - | |
| Thai Dessert/ | 02-Sep-2014 10:07 | - | |
| The Mummy/ | 02-Sep-2014 10:07 | - | |
| The Zodiacs/ | 02-Sep-2014 10:07 | - | |
| Travel Guide/ | 02-Sep-2014 10:07 | - | |
| Weekday Activities/ | 02-Sep-2014 10:07 | - | |
| What's he like/ | 02-Sep-2014 10:07 | - | |
| Your Bones/ | 02-Sep-2014 10:07 | - | |
| desktop.ini | 04-Dec-2015 10:27 | 136 | |